C28H20O4 — CID 122214288
7-(4-phenylphenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione (PubChem CID 122214288) has the molecular formula C28H20O4 and a molecular weight of 420.46 g/mol. Its IUPAC name is 7-(4-phenylphenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione.
| Compound Name | 7-(4-phenylphenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione |
|---|---|
| PubChem CID | 122214288 |
| Molecular Formula | C28H20O4 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 7-(4-phenylphenyl)-7,9,10,11-tetrahydrochromeno[3,2-c]chromene-6,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(-c3ccccc3)cc1)c1c(c3ccccc3oc1=O)O2 |
| InChI | InChI=1S/C28H20O4/c29-21-10-6-12-23-25(21)24(19-15-13-18(14-16-19)17-7-2-1-3-8-17)26-27(31-23)20-9-4-5-11-22(20)32-28(26)30/h1-5,7-9,11,13-16,24H,6,10,12H2 |
| InChIKey | OMBSCAYULAUMOG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|