C17H14N2O2S2 — CID 53468180
5-phenyl-2,4-bis(sulfanylidene)-5,7,8,9-tetrahydro-1H-chromeno[2,3-d]pyrimidin-6-one (PubChem CID 53468180) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-phenyl-2,4-bis(sulfanylidene)-5,7,8,9-tetrahydro-1H-chromeno[2,3-d]pyrimidin-6-one.
| Compound Name | 5-phenyl-2,4-bis(sulfanylidene)-5,7,8,9-tetrahydro-1H-chromeno[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 53468180 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 5-phenyl-2,4-bis(sulfanylidene)-5,7,8,9-tetrahydro-1H-chromeno[2,3-d]pyrimidin-6-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)c1c([nH]c(=S)[nH]c1=S)O2 |
| InChI | InChI=1S/C17H14N2O2S2/c20-10-7-4-8-11-13(10)12(9-5-2-1-3-6-9)14-15(21-11)18-17(23)19-16(14)22/h1-3,5-6,12H,4,7-8H2,(H2,18,19,22,23) |
| InChIKey | GXUQTLNFSQSPPC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|