C20H17NO6 — CID 102090932
(2S,4S)-2-ethoxy-4-(4-nitrophenyl)-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one (PubChem CID 102090932) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is (2S,4S)-2-ethoxy-4-(4-nitrophenyl)-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | (2S,4S)-2-ethoxy-4-(4-nitrophenyl)-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 102090932 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (2S,4S)-2-ethoxy-4-(4-nitrophenyl)-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
| SMILES | CCO[C@@H]1C[C@@H](c2ccc([N+](=O)[O-])cc2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C20H17NO6/c1-2-25-17-11-15(12-7-9-13(10-8-12)21(23)24)18-19(27-17)14-5-3-4-6-16(14)26-20(18)22/h3-10,15,17H,2,11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | RSNGKRWBGKROEB-RDJZCZTQSA-N |
| XLogP | 3.98 |
| TPSA | 91.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|