C30H21NO3 — CID 12971729
(2R,4R)-2-carbazol-9-yl-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one (PubChem CID 12971729) has the molecular formula C30H21NO3 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2R,4R)-2-carbazol-9-yl-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one.
| Compound Name | (2R,4R)-2-carbazol-9-yl-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 12971729 |
| Molecular Formula | C30H21NO3 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (2R,4R)-2-carbazol-9-yl-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromen-5-one |
| SMILES | O=c1oc2ccccc2c2c1[C@@H](c1ccccc1)C[C@H](n1c3ccccc3c3ccccc31)O2 |
| InChI | InChI=1S/C30H21NO3/c32-30-28-23(19-10-2-1-3-11-19)18-27(34-29(28)22-14-6-9-17-26(22)33-30)31-24-15-7-4-12-20(24)21-13-5-8-16-25(21)31/h1-17,23,27H,18H2/t23-,27-/m1/s1 |
| InChIKey | KFQPWFSPCKUGMY-YIXXDRMTSA-N |
| XLogP | 7.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|