C19H14O5 — CID 10782063
methyl (2R,3R)-4-oxo-2-phenyl-2,3-dihydrofuro[3,2-c]chromene-3-carboxylate (PubChem CID 10782063) has the molecular formula C19H14O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is methyl (2R,3R)-4-oxo-2-phenyl-2,3-dihydrofuro[3,2-c]chromene-3-carboxylate.
| Compound Name | methyl (2R,3R)-4-oxo-2-phenyl-2,3-dihydrofuro[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 10782063 |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | methyl (2R,3R)-4-oxo-2-phenyl-2,3-dihydrofuro[3,2-c]chromene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1c2c(c3ccccc3oc2=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H14O5/c1-22-18(20)14-15-17(24-16(14)11-7-3-2-4-8-11)12-9-5-6-10-13(12)23-19(15)21/h2-10,14,16H,1H3/t14-,16+/m1/s1 |
| InChIKey | BVFXZETTWZGEKB-ZBFHGGJFSA-N |
| XLogP | 3.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|