C20H15FO5 — CID 45257851
methyl (3S,4R)-4-(4-fluorophenyl)-5-oxo-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate (PubChem CID 45257851) has the molecular formula C20H15FO5 and a molecular weight of 354.33 g/mol. Its IUPAC name is methyl (3S,4R)-4-(4-fluorophenyl)-5-oxo-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-(4-fluorophenyl)-5-oxo-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 45257851 |
| Molecular Formula | C20H15FO5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl (3S,4R)-4-(4-fluorophenyl)-5-oxo-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1COc2c(c(=O)oc3ccccc23)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FO5/c1-24-19(22)14-10-25-18-13-4-2-3-5-15(13)26-20(23)17(18)16(14)11-6-8-12(21)9-7-11/h2-9,14,16H,10H2,1H3/t14-,16+/m1/s1 |
| InChIKey | GPIMFJQFLCYWGJ-ZBFHGGJFSA-N |
| XLogP | 3.25 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|