C21H18O5 — CID 45257855
ethyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate (PubChem CID 45257855) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is ethyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate.
| Compound Name | ethyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 45257855 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | ethyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1COc2c(c(=O)oc3ccccc23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H18O5/c1-2-24-20(22)15-12-25-19-14-10-6-7-11-16(14)26-21(23)18(19)17(15)13-8-4-3-5-9-13/h3-11,15,17H,2,12H2,1H3/t15-,17+/m1/s1 |
| InChIKey | BNGKWMARGPIWIX-WBVHZDCISA-N |
| XLogP | 3.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|