C23H22O5 — CID 45257856
butyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate (PubChem CID 45257856) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is butyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate.
| Compound Name | butyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
|---|---|
| PubChem CID | 45257856 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | butyl (3S,4R)-5-oxo-4-phenyl-3,4-dihydro-2H-pyrano[3,2-c]chromene-3-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1COc2c(c(=O)oc3ccccc23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H22O5/c1-2-3-13-26-22(24)17-14-27-21-16-11-7-8-12-18(16)28-23(25)20(21)19(17)15-9-5-4-6-10-15/h4-12,17,19H,2-3,13-14H2,1H3/t17-,19+/m1/s1 |
| InChIKey | VINUQQAOSNLJAM-MJGOQNOKSA-N |
| XLogP | 4.28 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|