C19H13FO5 — CID 97037790
methyl (2S,3R)-3-(4-fluorophenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 97037790) has the molecular formula C19H13FO5 and a molecular weight of 340.31 g/mol. Its IUPAC name is methyl (2S,3R)-3-(4-fluorophenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-(4-fluorophenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 97037790 |
| Molecular Formula | C19H13FO5 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl (2S,3R)-3-(4-fluorophenyl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)[C@H]1Oc2c(c(=O)oc3ccccc23)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13FO5/c1-23-19(22)17-14(10-6-8-11(20)9-7-10)15-16(25-17)12-4-2-3-5-13(12)24-18(15)21/h2-9,14,17H,1H3/t14-,17+/m1/s1 |
| InChIKey | DYLASHWOMLOUFB-PBHICJAKSA-N |
| XLogP | 3.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|