C20H15FO6 — CID 134944898
methyl 4-(4-fluorophenyl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate (PubChem CID 134944898) has the molecular formula C20H15FO6 and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 134944898 |
| Molecular Formula | C20H15FO6 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)C1(O)CC(c2ccc(F)cc2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C20H15FO6/c1-25-19(23)20(24)10-14(11-6-8-12(21)9-7-11)16-17(27-20)13-4-2-3-5-15(13)26-18(16)22/h2-9,14,24H,10H2,1H3 |
| InChIKey | NHXIJNUVUICVJX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|