C18H14O7 — CID 46914999
methyl (4S)-4-(furan-2-yl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate (PubChem CID 46914999) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is methyl (4S)-4-(furan-2-yl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl (4S)-4-(furan-2-yl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 46914999 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl (4S)-4-(furan-2-yl)-2-hydroxy-5-oxo-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)C1(O)C[C@H](c2ccco2)c2c(c3ccccc3oc2=O)O1 |
| InChI | InChI=1S/C18H14O7/c1-22-17(20)18(21)9-11(12-7-4-8-23-12)14-15(25-18)10-5-2-3-6-13(10)24-16(14)19/h2-8,11,21H,9H2,1H3/t11-,18?/m1/s1 |
| InChIKey | AUQXRMWXCXNQDW-SSJGJQFISA-N |
| XLogP | 2.16 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|