C24H18N2O4 — CID 139230054
4-(furan-2-yl)-2-methyl-5-oxo-N-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxamide (PubChem CID 139230054) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-(furan-2-yl)-2-methyl-5-oxo-N-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxamide.
| Compound Name | 4-(furan-2-yl)-2-methyl-5-oxo-N-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139230054 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-(furan-2-yl)-2-methyl-5-oxo-N-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccco2)c2c(c3ccccc3oc2=O)N1 |
| InChI | InChI=1S/C24H18N2O4/c1-14-19(23(27)26-15-8-3-2-4-9-15)20(18-12-7-13-29-18)21-22(25-14)16-10-5-6-11-17(16)30-24(21)28/h2-13,20,25H,1H3,(H,26,27) |
| InChIKey | VGAGRFOOLMRHSU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|