C27H20BrNO4 — CID 122232573
ethyl 2-(4-bromophenyl)-5-oxo-4-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxylate (PubChem CID 122232573) has the molecular formula C27H20BrNO4 and a molecular weight of 502.36 g/mol. Its IUPAC name is ethyl 2-(4-bromophenyl)-5-oxo-4-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-(4-bromophenyl)-5-oxo-4-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 122232573 |
| Molecular Formula | C27H20BrNO4 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | ethyl 2-(4-bromophenyl)-5-oxo-4-phenyl-1,4-dihydrochromeno[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(Br)cc2)Nc2c(c(=O)oc3ccccc23)C1c1ccccc1 |
| InChI | InChI=1S/C27H20BrNO4/c1-2-32-26(30)22-21(16-8-4-3-5-9-16)23-25(19-10-6-7-11-20(19)33-27(23)31)29-24(22)17-12-14-18(28)15-13-17/h3-15,21,29H,2H2,1H3 |
| InChIKey | FPCHHPDZDVSTCY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|