C22H19NO3 — CID 917052
ethyl (1R)-3-amino-1-phenyl-1H-benzo[f]chromene-2-carboxylate (PubChem CID 917052) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is ethyl (1R)-3-amino-1-phenyl-1H-benzo[f]chromene-2-carboxylate.
| Compound Name | ethyl (1R)-3-amino-1-phenyl-1H-benzo[f]chromene-2-carboxylate |
|---|---|
| PubChem CID | 917052 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl (1R)-3-amino-1-phenyl-1H-benzo[f]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2ccc3ccccc3c2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H19NO3/c1-2-25-22(24)20-18(15-9-4-3-5-10-15)19-16-11-7-6-8-14(16)12-13-17(19)26-21(20)23/h3-13,18H,2,23H2,1H3/t18-/m1/s1 |
| InChIKey | HQAKKJUVFWXIKJ-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |