C31H23NO5 — CID 19167233
ethyl 3-(1-benzofuran-2-carbonylamino)-1-phenyl-1H-benzo[f]chromene-2-carboxylate (PubChem CID 19167233) has the molecular formula C31H23NO5 and a molecular weight of 489.53 g/mol. Its IUPAC name is ethyl 3-(1-benzofuran-2-carbonylamino)-1-phenyl-1H-benzo[f]chromene-2-carboxylate.
| Compound Name | ethyl 3-(1-benzofuran-2-carbonylamino)-1-phenyl-1H-benzo[f]chromene-2-carboxylate |
|---|---|
| PubChem CID | 19167233 |
| Molecular Formula | C31H23NO5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | ethyl 3-(1-benzofuran-2-carbonylamino)-1-phenyl-1H-benzo[f]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(NC(=O)c2cc3ccccc3o2)Oc2ccc3ccccc3c2C1c1ccccc1 |
| InChI | InChI=1S/C31H23NO5/c1-2-35-31(34)28-26(20-11-4-3-5-12-20)27-22-14-8-6-10-19(22)16-17-24(27)37-30(28)32-29(33)25-18-21-13-7-9-15-23(21)36-25/h3-18,26H,2H2,1H3,(H,32,33) |
| InChIKey | JMJZAQZWABQVNM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |