C16H13NO4S — CID 8718221
ethyl 2-(1-benzofuran-2-carbonylamino)thiophene-3-carboxylate (PubChem CID 8718221) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl 2-(1-benzofuran-2-carbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(1-benzofuran-2-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 8718221 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | ethyl 2-(1-benzofuran-2-carbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H13NO4S/c1-2-20-16(19)11-7-8-22-15(11)17-14(18)13-9-10-5-3-4-6-12(10)21-13/h3-9H,2H2,1H3,(H,17,18) |
| InChIKey | RZEHVUWSBWHKLE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |