C21H19NO5 — CID 13473060
ethyl 5-(1-benzofuran-2-carbonylamino)-2-prop-2-enoxybenzoate (PubChem CID 13473060) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 5-(1-benzofuran-2-carbonylamino)-2-prop-2-enoxybenzoate.
| Compound Name | ethyl 5-(1-benzofuran-2-carbonylamino)-2-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 13473060 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | ethyl 5-(1-benzofuran-2-carbonylamino)-2-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(NC(=O)c2cc3ccccc3o2)cc1C(=O)OCC |
| InChI | InChI=1S/C21H19NO5/c1-3-11-26-18-10-9-15(13-16(18)21(24)25-4-2)22-20(23)19-12-14-7-5-6-8-17(14)27-19/h3,5-10,12-13H,1,4,11H2,2H3,(H,22,23) |
| InChIKey | HXQBSAYYHNUUMI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|