C23H18ClNO4S — CID 19241021
ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate (PubChem CID 19241021) has the molecular formula C23H18ClNO4S and a molecular weight of 439.92 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19241021 |
| Molecular Formula | C23H18ClNO4S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-5-methyl-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc3cc(Cl)ccc3o2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C23H18ClNO4S/c1-3-28-23(27)20-19(14-7-5-4-6-8-14)13(2)30-22(20)25-21(26)18-12-15-11-16(24)9-10-17(15)29-18/h4-12H,3H2,1-2H3,(H,25,26) |
| InChIKey | IVBTUBHMUJMOCZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|