C23H18ClNO5S — CID 19241025
ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 19241025) has the molecular formula C23H18ClNO5S and a molecular weight of 455.92 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19241025 |
| Molecular Formula | C23H18ClNO5S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | ethyl 2-[(5-chloro-1-benzofuran-2-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C23H18ClNO5S/c1-3-29-23(27)20-17(13-4-7-16(28-2)8-5-13)12-31-22(20)25-21(26)19-11-14-10-15(24)6-9-18(14)30-19/h4-12H,3H2,1-2H3,(H,25,26) |
| InChIKey | SINDCNJXQLHGSW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|