C23H22ClNO5S — CID 23995390
ethyl 2-[(2-acetyloxy-5-chlorophenyl)methylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 23995390) has the molecular formula C23H22ClNO5S and a molecular weight of 459.95 g/mol. Its IUPAC name is ethyl 2-[(2-acetyloxy-5-chlorophenyl)methylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-acetyloxy-5-chlorophenyl)methylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23995390 |
| Molecular Formula | C23H22ClNO5S |
| Molecular Weight | 459.95 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | ethyl 2-[(2-acetyloxy-5-chlorophenyl)methylamino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NCc1cc(Cl)ccc1OC(C)=O |
| InChI | InChI=1S/C23H22ClNO5S/c1-4-29-23(27)21-19(15-5-8-18(28-3)9-6-15)13-31-22(21)25-12-16-11-17(24)7-10-20(16)30-14(2)26/h5-11,13,25H,4,12H2,1-3H3 |
| InChIKey | AIVPCZBPVAQCNU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|