C20H27N2O4S+ — CID 2108169
[2-[[3-ethoxycarbonyl-4-(4-methoxyphenyl)thiophen-2-yl]amino]-2-oxoethyl]-diethylazanium (PubChem CID 2108169) has the molecular formula C20H27N2O4S+ and a molecular weight of 391.51 g/mol. Its IUPAC name is [2-[[3-ethoxycarbonyl-4-(4-methoxyphenyl)thiophen-2-yl]amino]-2-oxoethyl]-diethylazanium.
| Compound Name | [2-[[3-ethoxycarbonyl-4-(4-methoxyphenyl)thiophen-2-yl]amino]-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 2108169 |
| Molecular Formula | C20H27N2O4S+ |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [2-[[3-ethoxycarbonyl-4-(4-methoxyphenyl)thiophen-2-yl]amino]-2-oxoethyl]-diethylazanium |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)C[NH+](CC)CC |
| InChI | InChI=1S/C20H26N2O4S/c1-5-22(6-2)12-17(23)21-19-18(20(24)26-7-3)16(13-27-19)14-8-10-15(25-4)11-9-14/h8-11,13H,5-7,12H2,1-4H3,(H,21,23)/p+1 |
| InChIKey | ZPOULSNULNSCJI-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|