C18H22N2O4S2 — CID 84561309
ethyl 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 84561309) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is ethyl 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84561309 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 2-[[2-(2-aminoethylsulfanyl)acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CSCCN |
| InChI | InChI=1S/C18H22N2O4S2/c1-3-24-18(22)16-14(12-4-6-13(23-2)7-5-12)10-26-17(16)20-15(21)11-25-9-8-19/h4-7,10H,3,8-9,11,19H2,1-2H3,(H,20,21) |
| InChIKey | YCZATCWITUHBJC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|