C26H29NO6S — CID 84563502
ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate (PubChem CID 84563502) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84563502 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)Cc3ccc(OC)cc3OC)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H29NO6S/c1-5-13-33-19-10-7-17(8-11-19)21-16-34-25(24(21)26(29)32-6-2)27-23(28)14-18-9-12-20(30-3)15-22(18)31-4/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,27,28) |
| InChIKey | AMXYNZOHOSRNAM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|