C22H27NO6S2 — CID 18593902
ethyl 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate (PubChem CID 18593902) has the molecular formula C22H27NO6S2 and a molecular weight of 465.59 g/mol. Its IUPAC name is ethyl 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18593902 |
| Molecular Formula | C22H27NO6S2 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | ethyl 2-[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCCOc1ccc(-c2csc(NC(=O)CC3CCS(=O)(=O)C3)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H27NO6S2/c1-3-10-29-17-7-5-16(6-8-17)18-13-30-21(20(18)22(25)28-4-2)23-19(24)12-15-9-11-31(26,27)14-15/h5-8,13,15H,3-4,9-12,14H2,1-2H3,(H,23,24) |
| InChIKey | OEQAMXNOKSZRKN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|