C29H35NO4S — CID 19237094
ethyl 2-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19237094) has the molecular formula C29H35NO4S and a molecular weight of 493.67 g/mol. Its IUPAC name is ethyl 2-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19237094 |
| Molecular Formula | C29H35NO4S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | ethyl 2-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CCCOc1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C29H35NO4S/c1-6-29(4,5)22-14-16-23(17-15-22)34-18-8-9-25(31)30-27-26(28(32)33-7-2)24(19-35-27)21-12-10-20(3)11-13-21/h10-17,19H,6-9,18H2,1-5H3,(H,30,31) |
| InChIKey | HJEJOUKUCAQJQI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|