C28H33NO4S — CID 19207437
ethyl 4-(3,4-dimethylphenyl)-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate (PubChem CID 19207437) has the molecular formula C28H33NO4S and a molecular weight of 479.64 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethylphenyl)-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(3,4-dimethylphenyl)-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19207437 |
| Molecular Formula | C28H33NO4S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | ethyl 4-(3,4-dimethylphenyl)-2-[4-(4-propan-2-ylphenoxy)butanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)CCCOc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C28H33NO4S/c1-6-32-28(31)26-24(22-10-9-19(4)20(5)16-22)17-34-27(26)29-25(30)8-7-15-33-23-13-11-21(12-14-23)18(2)3/h9-14,16-18H,6-8,15H2,1-5H3,(H,29,30) |
| InChIKey | QGGVKWIRLOGGGV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|