C28H32BrNO5S — CID 19206360
ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate (PubChem CID 19206360) has the molecular formula C28H32BrNO5S and a molecular weight of 574.54 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19206360 |
| Molecular Formula | C28H32BrNO5S |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(4-ethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=O)CCCOc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C28H32BrNO5S/c1-5-33-21-12-9-19(10-13-21)22-17-36-27(26(22)28(32)34-6-2)30-25(31)8-7-15-35-24-14-11-20(18(3)4)16-23(24)29/h9-14,16-18H,5-8,15H2,1-4H3,(H,30,31) |
| InChIKey | MCIPVUXOSZNKPY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|