C26H29NO5S — CID 84563496
ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate (PubChem CID 84563496) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 84563496 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | ethyl 2-[[2-(2,4-dimethoxyphenyl)acetyl]amino]-4-(4-propan-2-ylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C(C)C)cc2)csc1NC(=O)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C26H29NO5S/c1-6-32-26(29)24-21(18-9-7-17(8-10-18)16(2)3)15-33-25(24)27-23(28)13-19-11-12-20(30-4)14-22(19)31-5/h7-12,14-16H,6,13H2,1-5H3,(H,27,28) |
| InChIKey | SYNKGHBSBKJHAO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|