C28H32BrNO4S — CID 19206358
ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19206358) has the molecular formula C28H32BrNO4S and a molecular weight of 558.54 g/mol. Its IUPAC name is ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19206358 |
| Molecular Formula | C28H32BrNO4S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | ethyl 2-[4-(2-bromo-4-propan-2-ylphenoxy)butanoylamino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)CCCOc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C28H32BrNO4S/c1-6-33-28(32)26-22(21-10-9-18(4)19(5)14-21)16-35-27(26)30-25(31)8-7-13-34-24-12-11-20(17(2)3)15-23(24)29/h9-12,14-17H,6-8,13H2,1-5H3,(H,30,31) |
| InChIKey | CEYXSLANLFBKHZ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|