C21H27NO4S — CID 35569964
ethyl 4-(4-ethoxyphenyl)-2-(2-ethylbutanoylamino)thiophene-3-carboxylate (PubChem CID 35569964) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is ethyl 4-(4-ethoxyphenyl)-2-(2-ethylbutanoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-ethoxyphenyl)-2-(2-ethylbutanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 35569964 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | ethyl 4-(4-ethoxyphenyl)-2-(2-ethylbutanoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=O)C(CC)CC |
| InChI | InChI=1S/C21H27NO4S/c1-5-14(6-2)19(23)22-20-18(21(24)26-8-4)17(13-27-20)15-9-11-16(12-10-15)25-7-3/h9-14H,5-8H2,1-4H3,(H,22,23) |
| InChIKey | QHJWPLGFUJLAPG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|