C29H34N2O12S2 — CID 4863594
ethyl 4-(4-ethoxyphenyl)-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 4863594) has the molecular formula C29H34N2O12S2 and a molecular weight of 666.73 g/mol. Its IUPAC name is ethyl 4-(4-ethoxyphenyl)-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-ethoxyphenyl)-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4863594 |
| Molecular Formula | C29H34N2O12S2 |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | ethyl 4-(4-ethoxyphenyl)-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=S)NC(=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C29H34N2O12S2/c1-7-38-20-11-9-19(10-12-20)21-14-45-27(23(21)28(37)39-8-2)31-29(44)30-26(36)25(43-18(6)35)24(42-17(5)34)22(41-16(4)33)13-40-15(3)32/h9-12,14,22,24-25H,7-8,13H2,1-6H3,(H2,30,31,36,44) |
| InChIKey | HENLSKAXNRPKGQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|