C27H30N2O11S2 — CID 4863589
ethyl 4-phenyl-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 4863589) has the molecular formula C27H30N2O11S2 and a molecular weight of 622.67 g/mol. Its IUPAC name is ethyl 4-phenyl-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4863589 |
| Molecular Formula | C27H30N2O11S2 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | ethyl 4-phenyl-2-(2,3,4,5-tetraacetyloxypentanoylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=S)NC(=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C27H30N2O11S2/c1-6-36-26(35)21-19(18-10-8-7-9-11-18)13-42-25(21)29-27(41)28-24(34)23(40-17(5)33)22(39-16(4)32)20(38-15(3)31)12-37-14(2)30/h7-11,13,20,22-23H,6,12H2,1-5H3,(H2,28,29,34,41) |
| InChIKey | KDUDGSLOOZEHLC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 172.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|