C28H23NO3S — CID 19174432
ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19174432) has the molecular formula C28H23NO3S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19174432 |
| Molecular Formula | C28H23NO3S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23NO3S/c1-2-32-28(31)25-24(22-16-10-5-11-17-22)19-33-27(25)29-26(30)23(21-14-8-4-9-15-21)18-20-12-6-3-7-13-20/h3-19H,2H2,1H3,(H,29,30)/b23-18+ |
| InChIKey | USZVLDBZQFAMNW-PTGBLXJZSA-N |
| XLogP | 6.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|