C29H23F2NO4S — CID 2311394
ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 2311394) has the molecular formula C29H23F2NO4S and a molecular weight of 519.57 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2311394 |
| Molecular Formula | C29H23F2NO4S |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | ethyl 2-[[(E)-3-[4-(difluoromethoxy)phenyl]-2-phenylprop-2-enoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)/C(=C/c1ccc(OC(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H23F2NO4S/c1-2-35-28(34)25-24(21-11-7-4-8-12-21)18-37-27(25)32-26(33)23(20-9-5-3-6-10-20)17-19-13-15-22(16-14-19)36-29(30)31/h3-18,29H,2H2,1H3,(H,32,33)/b23-17+ |
| InChIKey | WEDWTNQOZNDKBP-HAVVHWLPSA-N |
| XLogP | 7.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|