C24H19N3O5S2 — CID 19189003
ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]carbamothioylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19189003) has the molecular formula C24H19N3O5S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]carbamothioylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]carbamothioylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19189003 |
| Molecular Formula | C24H19N3O5S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | ethyl 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]carbamothioylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=S)NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H19N3O5S2/c1-2-32-23(31)19-17(14-8-4-3-5-9-14)13-34-20(19)26-24(33)25-18(28)12-27-21(29)15-10-6-7-11-16(15)22(27)30/h3-11,13H,2,12H2,1H3,(H2,25,26,28,33) |
| InChIKey | OWAVGYKBRQOBFD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|