C26H21BrN2O3S2 — CID 4863546
ethyl 4-(4-bromophenyl)-2-[(2-naphthalen-1-ylacetyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 4863546) has the molecular formula C26H21BrN2O3S2 and a molecular weight of 553.50 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[(2-naphthalen-1-ylacetyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[(2-naphthalen-1-ylacetyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4863546 |
| Molecular Formula | C26H21BrN2O3S2 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[(2-naphthalen-1-ylacetyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=S)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H21BrN2O3S2/c1-2-32-25(31)23-21(17-10-12-19(27)13-11-17)15-34-24(23)29-26(33)28-22(30)14-18-8-5-7-16-6-3-4-9-20(16)18/h3-13,15H,2,14H2,1H3,(H2,28,29,30,33) |
| InChIKey | PVCFDMZVHQAQOQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|