C32H33NO11S — CID 99693639
ethyl 4-(4-phenylphenyl)-2-[[(2R,3R,4S)-2,3,4,5-tetraacetyloxypentanoyl]amino]thiophene-3-carboxylate (PubChem CID 99693639) has the molecular formula C32H33NO11S and a molecular weight of 639.68 g/mol. Its IUPAC name is ethyl 4-(4-phenylphenyl)-2-[[(2R,3R,4S)-2,3,4,5-tetraacetyloxypentanoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-phenylphenyl)-2-[[(2R,3R,4S)-2,3,4,5-tetraacetyloxypentanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 99693639 |
| Molecular Formula | C32H33NO11S |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | ethyl 4-(4-phenylphenyl)-2-[[(2R,3R,4S)-2,3,4,5-tetraacetyloxypentanoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(-c3ccccc3)cc2)csc1NC(=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C32H33NO11S/c1-6-40-32(39)27-25(24-14-12-23(13-15-24)22-10-8-7-9-11-22)17-45-31(27)33-30(38)29(44-21(5)37)28(43-20(4)36)26(42-19(3)35)16-41-18(2)34/h7-15,17,26,28-29H,6,16H2,1-5H3,(H,33,38)/t26-,28+,29+/m0/s1 |
| InChIKey | LXKFWDNLLKDWAS-WIIGKZCBSA-N |
| XLogP | 4.56 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|