C24H27N2O3S+ — CID 7987122
[(1R)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]-propylazanium (PubChem CID 7987122) has the molecular formula C24H27N2O3S+ and a molecular weight of 423.56 g/mol. Its IUPAC name is [(1R)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]-propylazanium.
| Compound Name | [(1R)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]-propylazanium |
|---|---|
| PubChem CID | 7987122 |
| Molecular Formula | C24H27N2O3S+ |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [(1R)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl]-propylazanium |
| SMILES | CCC[NH2+][C@@H](C(=O)Nc1scc(-c2ccccc2)c1C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-3-15-25-21(18-13-9-6-10-14-18)22(27)26-23-20(24(28)29-4-2)19(16-30-23)17-11-7-5-8-12-17/h5-14,16,21,25H,3-4,15H2,1-2H3,(H,26,27)/p+1/t21-/m1/s1 |
| InChIKey | YJCWXWZNOKKDKR-OAQYLSRUSA-O |
| XLogP | 4.24 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|