C29H23NO7S — CID 2370664
[(1S)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2370664) has the molecular formula C29H23NO7S and a molecular weight of 529.57 g/mol. Its IUPAC name is [(1S)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(1S)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2370664 |
| Molecular Formula | C29H23NO7S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | [(1S)-2-[(3-ethoxycarbonyl-4-phenylthiophen-2-yl)amino]-2-oxo-1-phenylethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)[C@@H](OC(=O)c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C29H23NO7S/c1-2-34-29(33)24-21(18-9-5-3-6-10-18)16-38-27(24)30-26(31)25(19-11-7-4-8-12-19)37-28(32)20-13-14-22-23(15-20)36-17-35-22/h3-16,25H,2,17H2,1H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | MWXJEHMTRCERIZ-VWLOTQADSA-N |
| XLogP | 5.86 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|