C27H25NO3S — CID 4078761
ethyl 2-(naphthalene-2-carbonylamino)-4-(3,4,5-trimethylphenyl)thiophene-3-carboxylate (PubChem CID 4078761) has the molecular formula C27H25NO3S and a molecular weight of 443.57 g/mol. Its IUPAC name is ethyl 2-(naphthalene-2-carbonylamino)-4-(3,4,5-trimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(naphthalene-2-carbonylamino)-4-(3,4,5-trimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4078761 |
| Molecular Formula | C27H25NO3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | ethyl 2-(naphthalene-2-carbonylamino)-4-(3,4,5-trimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(C)c(C)c(C)c2)csc1NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H25NO3S/c1-5-31-27(30)24-23(22-12-16(2)18(4)17(3)13-22)15-32-26(24)28-25(29)21-11-10-19-8-6-7-9-20(19)14-21/h6-15H,5H2,1-4H3,(H,28,29) |
| InChIKey | SSJHDJSCOCECOH-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|