C28H24N2O5S — CID 43859547
ethyl 2-[[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 43859547) has the molecular formula C28H24N2O5S and a molecular weight of 500.58 g/mol. Its IUPAC name is ethyl 2-[[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 43859547 |
| Molecular Formula | C28H24N2O5S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | ethyl 2-[[4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)c1ccc(N2C(=O)C3CC=CCC3C2=O)cc1 |
| InChI | InChI=1S/C28H24N2O5S/c1-2-35-28(34)23-22(17-8-4-3-5-9-17)16-36-25(23)29-24(31)18-12-14-19(15-13-18)30-26(32)20-10-6-7-11-21(20)27(30)33/h3-9,12-16,20-21H,2,10-11H2,1H3,(H,29,31) |
| InChIKey | AXVAMBBZELXVIP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|