C25H24N2O4S — CID 21230144
ethyl 2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 21230144) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 21230144 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | ethyl 2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C1CC(=O)N(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C25H24N2O4S/c1-3-31-25(30)22-20(17-7-5-4-6-8-17)15-32-24(22)26-23(29)18-13-21(28)27(14-18)19-11-9-16(2)10-12-19/h4-12,15,18H,3,13-14H2,1-2H3,(H,26,29) |
| InChIKey | CSYGPAXZWGNCEQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|