C21H21F3N2O5S — CID 55605678
ethyl 4-(4-methoxyphenyl)-2-[[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 55605678) has the molecular formula C21H21F3N2O5S and a molecular weight of 470.47 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)-2-[[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methoxyphenyl)-2-[[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55605678 |
| Molecular Formula | C21H21F3N2O5S |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)-2-[[5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)C1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C21H21F3N2O5S/c1-3-31-20(29)17-15(12-4-6-14(30-2)7-5-12)10-32-19(17)25-18(28)13-8-16(27)26(9-13)11-21(22,23)24/h4-7,10,13H,3,8-9,11H2,1-2H3,(H,25,28) |
| InChIKey | NDSHQEYCAIGYFM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|