C16H13F3IN3O2S — CID 112819294
N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 112819294) has the molecular formula C16H13F3IN3O2S and a molecular weight of 495.26 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112819294 |
| Molecular Formula | C16H13F3IN3O2S |
| Molecular Weight | 495.26 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | N-[4-(4-iodophenyl)-1,3-thiazol-2-yl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(I)cc2)cs1)C1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H13F3IN3O2S/c17-16(18,19)8-23-6-10(5-13(23)24)14(25)22-15-21-12(7-26-15)9-1-3-11(20)4-2-9/h1-4,7,10H,5-6,8H2,(H,21,22,25) |
| InChIKey | IASAVXGXEGZOGY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|