C24H19ClN2O6S — CID 108803803
methyl 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate (PubChem CID 108803803) has the molecular formula C24H19ClN2O6S and a molecular weight of 498.94 g/mol. Its IUPAC name is methyl 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 108803803 |
| Molecular Formula | C24H19ClN2O6S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | methyl 2-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C24H19ClN2O6S/c1-31-24(30)21-17(13-2-4-15(25)5-3-13)11-34-23(21)26-22(29)14-8-20(28)27(10-14)16-6-7-18-19(9-16)33-12-32-18/h2-7,9,11,14H,8,10,12H2,1H3,(H,26,29) |
| InChIKey | MGJFTXRSBQFUMU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|