C24H26NO6S- — CID 73129788
3-[[3-ethoxycarbonyl-4-(4-ethoxyphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 73129788) has the molecular formula C24H26NO6S- and a molecular weight of 456.54 g/mol. Its IUPAC name is 3-[[3-ethoxycarbonyl-4-(4-ethoxyphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 3-[[3-ethoxycarbonyl-4-(4-ethoxyphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 73129788 |
| Molecular Formula | C24H26NO6S- |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[[3-ethoxycarbonyl-4-(4-ethoxyphenyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC)cc2)csc1NC(=O)C1C2CCC(C2)C1C(=O)[O-] |
| InChI | InChI=1S/C24H27NO6S/c1-3-30-16-9-7-13(8-10-16)17-12-32-22(20(17)24(29)31-4-2)25-21(26)18-14-5-6-15(11-14)19(18)23(27)28/h7-10,12,14-15,18-19H,3-6,11H2,1-2H3,(H,25,26)(H,27,28)/p-1 |
| InChIKey | HYPKAIDGEUIXKD-UHFFFAOYSA-M |
| XLogP | 3.34 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|