C26H25NO5S — CID 124723740
(1S,2R,3S,4S)-3-[(3-ethoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124723740) has the molecular formula C26H25NO5S and a molecular weight of 463.56 g/mol. Its IUPAC name is (1S,2R,3S,4S)-3-[(3-ethoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4S)-3-[(3-ethoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124723740 |
| Molecular Formula | C26H25NO5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (1S,2R,3S,4S)-3-[(3-ethoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1c(-c2cccc3ccccc23)csc1NC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@H]1C(=O)O |
| InChI | InChI=1S/C26H25NO5S/c1-2-32-26(31)22-19(18-9-5-7-14-6-3-4-8-17(14)18)13-33-24(22)27-23(28)20-15-10-11-16(12-15)21(20)25(29)30/h3-9,13,15-16,20-21H,2,10-12H2,1H3,(H,27,28)(H,29,30)/t15-,16-,20-,21+/m0/s1 |
| InChIKey | XEFTURXBGVCKDL-SNHGZMDHSA-N |
| XLogP | 5.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|