C23H31NO5S — CID 27527140
(1S,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 27527140) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 27527140 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (1S,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C(=O)O)sc2c1CCCCCCC2 |
| InChI | InChI=1S/C23H31NO5S/c1-2-29-23(28)19-15-8-6-4-3-5-7-9-16(15)30-21(19)24-20(25)17-13-10-11-14(12-13)18(17)22(26)27/h13-14,17-18H,2-12H2,1H3,(H,24,25)(H,26,27)/t13-,14+,17-,18+/m1/s1 |
| InChIKey | VRBIPJVKMDFXNW-NONVJHHQSA-N |
| XLogP | 4.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'} |
|---|