C26H35NO5S — CID 98338506
(1R,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 98338506) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98338506 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | (1R,2S,3R,4R)-3-[(3-ethoxycarbonyl-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophen-2-yl)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H]2[C@@H](C(=O)O)[C@H]3CC[C@H]2C3=C(C)C)sc2c1CCCCCCC2 |
| InChI | InChI=1S/C26H35NO5S/c1-4-32-26(31)22-15-10-8-6-5-7-9-11-18(15)33-24(22)27-23(28)20-16-12-13-17(19(16)14(2)3)21(20)25(29)30/h16-17,20-21H,4-13H2,1-3H3,(H,27,28)(H,29,30)/t16-,17-,20+,21-/m0/s1 |
| InChIKey | LJIWTCOZEBXBSZ-PZBISTMVSA-N |
| XLogP | 5.61 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|