C26H25NO5S — CID 29056225
(1S,6S)-6-[(3-methoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 29056225) has the molecular formula C26H25NO5S and a molecular weight of 463.56 g/mol. Its IUPAC name is (1S,6S)-6-[(3-methoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(3-methoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 29056225 |
| Molecular Formula | C26H25NO5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (1S,6S)-6-[(3-methoxycarbonyl-4-naphthalen-1-ylthiophen-2-yl)carbamoyl]-3,4-dimethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)c1c(-c2cccc3ccccc23)csc1NC(=O)[C@H]1CC(C)=C(C)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C26H25NO5S/c1-14-11-19(20(25(29)30)12-15(14)2)23(28)27-24-22(26(31)32-3)21(13-33-24)18-10-6-8-16-7-4-5-9-17(16)18/h4-10,13,19-20H,11-12H2,1-3H3,(H,27,28)(H,29,30)/t19-,20-/m0/s1 |
| InChIKey | AZALBOXABMGNRY-PMACEKPBSA-N |
| XLogP | 5.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|